CAS 554408-52-5 appears in our catalog under these names: 7-Methyl-2-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyrimidin-5-amine, 95%, 7-Methyl-2-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyrimidin-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
7-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine (CAS 554408-52-5) is a chemical compound with the molecular formula C7H6F3N5 and a molecular weight of 217.15 g/mol. IUPAC name: 7-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine. InChIKey: JHLAEDYPMUOURZ-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N5 |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 7-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
| InChIKey | JHLAEDYPMUOURZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)C(F)(F)F)N |
Computed by PubChem (NCBI)