CAS 1601258-68-7 is the registry number for (2-(4-Bromo-3,5-dimethylphenyl)-1H-imidazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(4-bromo-3,5-dimethylphenyl)-1H-imidazol-5-yl]methanol (CAS 1601258-68-7) is a chemical compound with the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. IUPAC name: [2-(4-bromo-3,5-dimethylphenyl)-1H-imidazol-5-yl]methanol. InChIKey: MFLPYLDMFHOCPF-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | [2-(4-bromo-3,5-dimethylphenyl)-1H-imidazol-5-yl]methanol |
| InChIKey | MFLPYLDMFHOCPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)C2=NC=C(N2)CO |
Computed by PubChem (NCBI)