Products 676131-65-0
CAS 676131-65-0 appears in our catalog under these names: 3-(4-Bromophenyl)-5-tert-butyl-1,2,4-oxadiazole, 97%, 3-(4-Bromophenyl)-5-(tert-butyl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
3-(4-bromophenyl)-5-tert-butyl-1,2,4-oxadiazole (CAS 676131-65-0) is a chemical compound with the molecular formula C12H13BrN2O and a molecular weight of 281.15 g/mol. IUPAC name: 3-(4-bromophenyl)-5-tert-butyl-1,2,4-oxadiazole. InChIKey: QXVWMOMVFJMHJB-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 3-(4-bromophenyl)-5-tert-butyl-1,2,4-oxadiazole |
| InChIKey | QXVWMOMVFJMHJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NO1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)