Products 160135-92-2
CAS 160135-92-2 is the registry number for Gemopatrilat. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
2-[(6S)-2,2-dimethyl-7-oxo-6-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid (CAS 160135-92-2) is a chemical compound with the molecular formula C19H26N2O4S and a molecular weight of 378.5 g/mol. IUPAC name: 2-[(6S)-2,2-dimethyl-7-oxo-6-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid. InChIKey: YRSVDSQRGBYVIY-GJZGRUSLSA-N.
| Molecular formula | C19H26N2O4S |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 2-[(6S)-2,2-dimethyl-7-oxo-6-[[(2S)-3-phenyl-2-sulfanylpropanoyl]amino]azepan-1-yl]acetic acid |
| InChIKey | YRSVDSQRGBYVIY-GJZGRUSLSA-N |
| SMILES | CC1(CCC[C@@H](C(=O)N1CC(=O)O)NC(=O)[C@H](CC2=CC=CC=C2)S)C |
Computed by PubChem (NCBI)