Products 687568-55-4
CAS 687568-55-4 is the registry number for N,N-Diethyl-3-methyl-2-(piperidine-1-carbonyl)benzofuran-5-sulfonamide, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
N,N-diethyl-3-methyl-2-(piperidine-1-carbonyl)-1-benzofuran-5-sulfonamide (CAS 687568-55-4) is a chemical compound with the molecular formula C19H26N2O4S and a molecular weight of 378.5 g/mol. IUPAC name: N,N-diethyl-3-methyl-2-(piperidine-1-carbonyl)-1-benzofuran-5-sulfonamide. InChIKey: MZDUZZDFPSQLII-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O4S |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | N,N-diethyl-3-methyl-2-(piperidine-1-carbonyl)-1-benzofuran-5-sulfonamide |
| InChIKey | MZDUZZDFPSQLII-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC2=C(C=C1)OC(=C2C)C(=O)N3CCCCC3 |
Computed by PubChem (NCBI)