CAS 1601485-40-8 appears in our catalog under these names: 5,5'-(Pyrimidine-2,5-diyl)diisophthalic acid, 95%, 5,5'-(Pyrimidine-2,5-diyl)diisophthalic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-[2-(3,5-dicarboxyphenyl)pyrimidin-5-yl]benzene-1,3-dicarboxylic acid (CAS 1601485-40-8) is a chemical compound with the molecular formula C20H12N2O8 and a molecular weight of 408.3 g/mol. IUPAC name: 5-[2-(3,5-dicarboxyphenyl)pyrimidin-5-yl]benzene-1,3-dicarboxylic acid. InChIKey: IXQYQWKCCRKMDH-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O8 |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 5-[2-(3,5-dicarboxyphenyl)pyrimidin-5-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | IXQYQWKCCRKMDH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CN=C(N=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)