CAS 2757730-24-6 appears in our catalog under these names: 5,5'-(Pyrazine-2,6-diyl)diisophthalic acid, 95%, 95%, 5,5'-(Pyrazine-2,6-diyl)diisophthalicacid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-[6-(3,5-dicarboxyphenyl)pyrazin-2-yl]benzene-1,3-dicarboxylic acid (CAS 2757730-24-6) is a chemical compound with the molecular formula C20H12N2O8 and a molecular weight of 408.3 g/mol. IUPAC name: 5-[6-(3,5-dicarboxyphenyl)pyrazin-2-yl]benzene-1,3-dicarboxylic acid. InChIKey: GQKPHYZMAWZSTA-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O8 |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 5-[6-(3,5-dicarboxyphenyl)pyrazin-2-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | GQKPHYZMAWZSTA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C2=CN=CC(=N2)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)