CAS 16017-53-1 is the registry number for 1-(4-Chloro-benzenesulfonyl)-piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 10g.
1-(4-chlorophenyl)sulfonylpiperazine (CAS 16017-53-1) is a chemical compound with the molecular formula C10H13ClN2O2S and a molecular weight of 260.74 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpiperazine. InChIKey: CKVKEBVACPUEIB-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpiperazine |
| InChIKey | CKVKEBVACPUEIB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)