Products 2788911-90-8
CAS 2788911-90-8 is the registry number for tert-Butyl (3-chloro-4-mercaptopyridin-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-chloro-4-sulfanylidene-1H-pyridin-2-yl)carbamate (CAS 2788911-90-8) is a chemical compound with the molecular formula C10H13ClN2O2S and a molecular weight of 260.74 g/mol. IUPAC name: tert-butyl N-(3-chloro-4-sulfanylidene-1H-pyridin-2-yl)carbamate. InChIKey: KVXJLGZAZYMXQT-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-4-sulfanylidene-1H-pyridin-2-yl)carbamate |
| InChIKey | KVXJLGZAZYMXQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=S)C=CN1)Cl |
Computed by PubChem (NCBI)