Products 160254-73-9
CAS 160254-73-9 is the registry number for 3-(Naphthalen-1-yl)-1-phenylprop-2-yn-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
3-naphthalen-1-yl-1-phenylprop-2-yn-1-one (CAS 160254-73-9) is a chemical compound with the molecular formula C19H12O and a molecular weight of 256.3 g/mol. IUPAC name: 3-naphthalen-1-yl-1-phenylprop-2-yn-1-one. InChIKey: PXPZUDMSVYUTNY-UHFFFAOYSA-N.
| Molecular formula | C19H12O |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 3-naphthalen-1-yl-1-phenylprop-2-yn-1-one |
| InChIKey | PXPZUDMSVYUTNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C#CC2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)