CAS 1850307-81-1 is the registry number for 8-(Phenylethynyl)-1-naphthaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(2-phenylethynyl)naphthalene-1-carbaldehyde (CAS 1850307-81-1) is a chemical compound with the molecular formula C19H12O and a molecular weight of 256.3 g/mol. IUPAC name: 8-(2-phenylethynyl)naphthalene-1-carbaldehyde. InChIKey: VMQMCOGIFBQPGS-UHFFFAOYSA-N.
| Molecular formula | C19H12O |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 8-(2-phenylethynyl)naphthalene-1-carbaldehyde |
| InChIKey | VMQMCOGIFBQPGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=CC3=C2C(=CC=C3)C=O |
Computed by PubChem (NCBI)