CAS 1602712-84-4 appears in our catalog under these names: 4–Chloro–5–(chlorosulfonyl)–2–fluorobenzoyl chloride, 4-CHLORO-5-(CHLOROSULFONYL)-2-FLUOROBENZOYL CHLORIDE, 95%, 4-Chloro-5-(chlorosulfonyl)-2-fluorobenzoyl chloride, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
4-chloro-5-chlorosulfonyl-2-fluorobenzoyl chloride (CAS 1602712-84-4) is a chemical compound with the molecular formula C7H2Cl3FO3S and a molecular weight of 291.5 g/mol. IUPAC name: 4-chloro-5-chlorosulfonyl-2-fluorobenzoyl chloride. InChIKey: LRQAQLKSYUHFOH-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3FO3S |
|---|---|
| Molecular weight | 291.5 g/mol |
| IUPAC name | 4-chloro-5-chlorosulfonyl-2-fluorobenzoyl chloride |
| InChIKey | LRQAQLKSYUHFOH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)F)C(=O)Cl |
Computed by PubChem (NCBI)