Products 866763-17-9

CAS 866763-17-9 appears in our catalog under these names: 2–Chloro–5–(chlorosulfonyl)–4–fluorobenzoyl chloride, 2-Chloro-5-(chlorosulfonyl)-4-fluorobenzoyl chloride, 90%, 90%, 2-CHLORO-5-(CHLOROSULFONYL)-4-FLUOROBENZOYL CHLORIDE, 90%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-5-chlorosulfonyl-4-fluorobenzoyl chloride (CAS 866763-17-9) is a chemical compound with the molecular formula C7H2Cl3FO3S and a molecular weight of 291.5 g/mol. IUPAC name: 2-chloro-5-chlorosulfonyl-4-fluorobenzoyl chloride. InChIKey: LARUSNHLTMTCIV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2Cl3FO3S
Molecular weight291.5 g/mol
IUPAC name2-chloro-5-chlorosulfonyl-4-fluorobenzoyl chloride
InChIKeyLARUSNHLTMTCIV-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1S(=O)(=O)Cl)F)Cl)C(=O)Cl

Computed by PubChem (NCBI)