CAS 1602975-52-9 appears in our catalog under these names: 4-Chloro-7,8-difluoroquinolin-3-amine, 95%, 4-Chloro-7,8-difluoroquinolin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-chloro-7,8-difluoroquinolin-3-amine (CAS 1602975-52-9) is a chemical compound with the molecular formula C9H5ClF2N2 and a molecular weight of 214.60 g/mol. IUPAC name: 4-chloro-7,8-difluoroquinolin-3-amine. InChIKey: RQKJDQYRLMUVOG-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF2N2 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 4-chloro-7,8-difluoroquinolin-3-amine |
| InChIKey | RQKJDQYRLMUVOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=C(C(=C21)Cl)N)F)F |
Computed by PubChem (NCBI)