CAS 2508759-71-3 is the registry number for 5-Chloro-2-(difluoromethyl)-1,8-naphthyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-(difluoromethyl)-1,8-naphthyridine (CAS 2508759-71-3) is a chemical compound with the molecular formula C9H5ClF2N2 and a molecular weight of 214.60 g/mol. IUPAC name: 5-chloro-2-(difluoromethyl)-1,8-naphthyridine. InChIKey: NJDMVCKLZQQLPC-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF2N2 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 5-chloro-2-(difluoromethyl)-1,8-naphthyridine |
| InChIKey | NJDMVCKLZQQLPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=CC(=C21)Cl)C(F)F |
Computed by PubChem (NCBI)