Products 16031-83-7

CAS 16031-83-7 is the registry number for 3-(2-Aminoethyl)-5-hydroxyindole adipate salt. Offered by: Biosynth. Available pack sizes: 500g.

Structural formula: {0} (CAS {1})

3-(2-aminoethyl)-1H-indol-5-ol;hexanedioic acid (CAS 16031-83-7) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indol-5-ol;hexanedioic acid. InChIKey: QUDKLAIWRJDCMU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22N2O5
Molecular weight322.36 g/mol
IUPAC name3-(2-aminoethyl)-1H-indol-5-ol;hexanedioic acid
InChIKeyQUDKLAIWRJDCMU-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1O)C(=CN2)CCN.C(CCC(=O)O)CC(=O)O

Computed by PubChem (NCBI)