Products 1603109-80-3

CAS 1603109-80-3 is the registry number for Tetrahydro-​3-​methoxy-​3-​thiophenecarboxylic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-methoxy-1,1-dioxothiolane-3-carboxylic acid (CAS 1603109-80-3) is a chemical compound with the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. IUPAC name: 3-methoxy-1,1-dioxothiolane-3-carboxylic acid. InChIKey: UYGUSLSSJSXRSL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10O5S
Molecular weight194.21 g/mol
IUPAC name3-methoxy-1,1-dioxothiolane-3-carboxylic acid
InChIKeyUYGUSLSSJSXRSL-UHFFFAOYSA-N
SMILESCOC1(CCS(=O)(=O)C1)C(=O)O

Computed by PubChem (NCBI)