CAS 1603109-80-3 is the registry number for Tetrahydro-​3-​methoxy-​3-​thiophenecarboxylic acid 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methoxy-1,1-dioxothiolane-3-carboxylic acid (CAS 1603109-80-3) is a chemical compound with the molecular formula C6H10O5S and a molecular weight of 194.21 g/mol. IUPAC name: 3-methoxy-1,1-dioxothiolane-3-carboxylic acid. InChIKey: UYGUSLSSJSXRSL-UHFFFAOYSA-N.
| Molecular formula | C6H10O5S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 3-methoxy-1,1-dioxothiolane-3-carboxylic acid |
| InChIKey | UYGUSLSSJSXRSL-UHFFFAOYSA-N |
| SMILES | COC1(CCS(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)