CAS 16039-53-5 appears in our catalog under these names: Zinc lactate, 97%, Zinc lactate, Zinc lactate, (T-4)-Bis[2-(hydroxy-κO)propanoato-κO]zinc 98%, Zinc lactate, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 500g, 2kg, 1kg, 5kg.
Zinc bis(2-hydroxypropanoate) (CAS 16039-53-5) is a chemical compound with the molecular formula C6H10O6Zn and a molecular weight of 243.5 g/mol. IUPAC name: zinc bis(2-hydroxypropanoate). InChIKey: CANRESZKMUPMAE-UHFFFAOYSA-L.
| Molecular formula | C6H10O6Zn |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | zinc bis(2-hydroxypropanoate) |
| InChIKey | CANRESZKMUPMAE-UHFFFAOYSA-L |
| SMILES | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Zn+2] |
Computed by PubChem (NCBI)