CAS 6155-68-6 is the registry number for Propanoic acid, 2-hydroxy-, zinc salt (1:1), (2S)-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100g, 500g.
Zinc bis(2-hydroxypropanoate) (CAS 6155-68-6) is a chemical compound with the molecular formula C6H10O6Zn and a molecular weight of 243.5 g/mol. IUPAC name: zinc bis(2-hydroxypropanoate). InChIKey: CANRESZKMUPMAE-UHFFFAOYSA-L.
| Molecular formula | C6H10O6Zn |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | zinc bis(2-hydroxypropanoate) |
| InChIKey | CANRESZKMUPMAE-UHFFFAOYSA-L |
| SMILES | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Zn+2] |
Computed by PubChem (NCBI)