Products 16041-56-8
CAS 16041-56-8 is the registry number for (2R*,4Ar*,8ar*)-2-methyloctahydro-4(1h)-quinolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(2R,4aR,8aR)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one (CAS 16041-56-8) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: (2R,4aR,8aR)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one. InChIKey: SEAPKWHFVCCJBB-IWSPIJDZSA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | (2R,4aR,8aR)-2-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
| InChIKey | SEAPKWHFVCCJBB-IWSPIJDZSA-N |
| SMILES | C[C@@H]1CC(=O)[C@@H]2CCCC[C@H]2N1 |
Computed by PubChem (NCBI)