CAS 1604406-53-2 is the registry number for (S)-6-Bromo-2,2-dimethylchroman-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine (CAS 1604406-53-2) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: (4S)-6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine. InChIKey: PXJLFYGCARIYEH-VIFPVBQESA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | (4S)-6-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| InChIKey | PXJLFYGCARIYEH-VIFPVBQESA-N |
| SMILES | CC1(C[C@@H](C2=C(O1)C=CC(=C2)Br)N)C |
Computed by PubChem (NCBI)