Products 1605330-23-1
CAS 1605330-23-1 is the registry number for 3-Bromo-n,n-dimethyl-5-(methylsulfonamido)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-(methanesulfonamido)-N,N-dimethylbenzamide (CAS 1605330-23-1) is a chemical compound with the molecular formula C10H13BrN2O3S and a molecular weight of 321.19 g/mol. IUPAC name: 3-bromo-5-(methanesulfonamido)-N,N-dimethylbenzamide. InChIKey: WRVXNQPSXWPWFB-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3S |
|---|---|
| Molecular weight | 321.19 g/mol |
| IUPAC name | 3-bromo-5-(methanesulfonamido)-N,N-dimethylbenzamide |
| InChIKey | WRVXNQPSXWPWFB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)Br)NS(=O)(=O)C |
Computed by PubChem (NCBI)