CAS 494833-78-2 is the registry number for tert-Butyl (5-bromo-2-carbamoylthiophen-3-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl N-(5-bromo-2-carbamoylthiophen-3-yl)carbamate (CAS 494833-78-2) is a chemical compound with the molecular formula C10H13BrN2O3S and a molecular weight of 321.19 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-carbamoylthiophen-3-yl)carbamate. InChIKey: UNHVXNCODKMFPR-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2O3S |
|---|---|
| Molecular weight | 321.19 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-carbamoylthiophen-3-yl)carbamate |
| InChIKey | UNHVXNCODKMFPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(SC(=C1)Br)C(=O)N |
Computed by PubChem (NCBI)