CAS 1606127-56-3 appears in our catalog under these names: N-(4'-Chloro-[1,1'-biphenyl]-2-yl)-2-hydroxynicotinamide, 95%, Hydroxy-Boscalid. Offered by: Combi-blocks, HPC Standards. Available pack sizes: 250mg, 1g, 1x5mg.
N-[2-(4-chlorophenyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide (CAS 1606127-56-3) is a chemical compound with the molecular formula C18H13ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: N-[2-(4-chlorophenyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide. InChIKey: ZYUBAIGTGFMEPF-UHFFFAOYSA-N.
| Molecular formula | C18H13ClN2O2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | N-[2-(4-chlorophenyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| InChIKey | ZYUBAIGTGFMEPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)NC(=O)C3=CC=CNC3=O |
Computed by PubChem (NCBI)