CAS 310460-39-0 appears in our catalog under these names: Cpypp, 95%, CPYPP, CPYPP/ 99.85% (existing batch purity), CPYPP 97%, 4-(3-(2-Chlorophenyl)allylidene)-1-phenylpyrazolidine-3,5-dione, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 10mg, 50mg, 1mg, 5mg, 25mg.
(4E)-4-[(E)-3-(2-chlorophenyl)prop-2-enylidene]-1-phenylpyrazolidine-3,5-dione (CAS 310460-39-0) is a chemical compound with the molecular formula C18H13ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: (4E)-4-[(E)-3-(2-chlorophenyl)prop-2-enylidene]-1-phenylpyrazolidine-3,5-dione. InChIKey: VVZJFICTTKPNCK-KVDBUQHUSA-N.
| Molecular formula | C18H13ClN2O2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | (4E)-4-[(E)-3-(2-chlorophenyl)prop-2-enylidene]-1-phenylpyrazolidine-3,5-dione |
| InChIKey | VVZJFICTTKPNCK-KVDBUQHUSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)/C(=C/C=C/C3=CC=CC=C3Cl)/C(=O)N2 |
Computed by PubChem (NCBI)