CAS 160616-03-5 is the registry number for N-(9-((2R)-2-Hydroxypropyl)-9H-purin-6-yl)benzamide. Offered by: Mikromol. Available pack sizes: 25mg.
N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide (CAS 160616-03-5) is a chemical compound with the molecular formula C15H15N5O2 and a molecular weight of 297.31 g/mol. IUPAC name: N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide. InChIKey: DZTLHJVINSWGSG-SNVBAGLBSA-N.
| Molecular formula | C15H15N5O2 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | N-[9-[(2R)-2-hydroxypropyl]purin-6-yl]benzamide |
| InChIKey | DZTLHJVINSWGSG-SNVBAGLBSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)NC(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)