CAS 192705-78-5 is the registry number for 6-(3,5-Dimethoxyphenyl)pyrido(2,3-d)pyrimidine-2,7-diamine. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (CAS 192705-78-5) is a chemical compound with the molecular formula C15H15N5O2 and a molecular weight of 297.31 g/mol. IUPAC name: 6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine. InChIKey: LOIKOLAEHONJTE-UHFFFAOYSA-N.
| Molecular formula | C15H15N5O2 |
|---|---|
| Molecular weight | 297.31 g/mol |
| IUPAC name | 6-(3,5-dimethoxyphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| InChIKey | LOIKOLAEHONJTE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=C(N=C3C(=C2)C=NC(=N3)N)N)OC |
Computed by PubChem (NCBI)