CAS 16064-21-4 appears in our catalog under these names: 2-Thioxo-2,3,5,6,7,8-hexahydro-4(1H)-quinazolinone, 2-Thioxo-2,3,5,6,7,8-hexahydroquinazolin-4(1H)-one, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 1g, 5g.
2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazolin-4-one (CAS 16064-21-4) is a chemical compound with the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. IUPAC name: 2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazolin-4-one. InChIKey: BRCPOVNFTXLBPI-UHFFFAOYSA-N.
| Molecular formula | C8H10N2OS |
|---|---|
| Molecular weight | 182.25 g/mol |
| IUPAC name | 2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazolin-4-one |
| InChIKey | BRCPOVNFTXLBPI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)