Products 1606999-00-1
CAS 1606999-00-1 is the registry number for (5-Bromofuran-2-yl)(1,4-diazepan-1-yl)methanone hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-bromofuran-2-yl)-(1,4-diazepan-1-yl)methanone;hydrochloride (CAS 1606999-00-1) is a chemical compound with the molecular formula C10H14BrClN2O2 and a molecular weight of 309.59 g/mol. IUPAC name: (5-bromofuran-2-yl)-(1,4-diazepan-1-yl)methanone;hydrochloride. InChIKey: PEEUYLQYSSNYND-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2O2 |
|---|---|
| Molecular weight | 309.59 g/mol |
| IUPAC name | (5-bromofuran-2-yl)-(1,4-diazepan-1-yl)methanone;hydrochloride |
| InChIKey | PEEUYLQYSSNYND-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=CC=C(O2)Br.Cl |
Computed by PubChem (NCBI)