Products 2768549-01-3

CAS 2768549-01-3 is the registry number for Ethyl 3-amino-3-(4-bromopyridin-2-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride (CAS 2768549-01-3) is a chemical compound with the molecular formula C10H14BrClN2O2 and a molecular weight of 309.59 g/mol. IUPAC name: ethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride. InChIKey: WUUDIFHBGRPZQA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14BrClN2O2
Molecular weight309.59 g/mol
IUPAC nameethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride
InChIKeyWUUDIFHBGRPZQA-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C1=NC=CC(=C1)Br)N.Cl

Computed by PubChem (NCBI)