CAS 2768549-01-3 is the registry number for Ethyl 3-amino-3-(4-bromopyridin-2-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride (CAS 2768549-01-3) is a chemical compound with the molecular formula C10H14BrClN2O2 and a molecular weight of 309.59 g/mol. IUPAC name: ethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride. InChIKey: WUUDIFHBGRPZQA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrClN2O2 |
|---|---|
| Molecular weight | 309.59 g/mol |
| IUPAC name | ethyl 3-amino-3-(4-bromo-2-pyridinyl)propanoate;hydrochloride |
| InChIKey | WUUDIFHBGRPZQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=NC=CC(=C1)Br)N.Cl |
Computed by PubChem (NCBI)