CAS 1607281-07-1 appears in our catalog under these names: Potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate, 95%, Potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate (CAS 1607281-07-1) is a chemical compound with the molecular formula C5H5KN2O4 and a molecular weight of 196.20 g/mol. IUPAC name: potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate. InChIKey: DGAQZTLUJLLRDN-UHFFFAOYSA-M.
| Molecular formula | C5H5KN2O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | potassium 5-(methoxymethyl)-1,2,4-oxadiazole-3-carboxylate |
| InChIKey | DGAQZTLUJLLRDN-UHFFFAOYSA-M |
| SMILES | COCC1=NC(=NO1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)