CAS 2230803-18-4 is the registry number for Potassium 3-(methoxymethyl)-1,2,4-oxadiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Potassium 3-(methoxymethyl)-1,2,4-oxadiazole-5-carboxylate (CAS 2230803-18-4) is a chemical compound with the molecular formula C5H5KN2O4 and a molecular weight of 196.20 g/mol. IUPAC name: potassium 3-(methoxymethyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: IFPNKPFRLBKXAI-UHFFFAOYSA-M.
| Molecular formula | C5H5KN2O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | potassium 3-(methoxymethyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | IFPNKPFRLBKXAI-UHFFFAOYSA-M |
| SMILES | COCC1=NOC(=N1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)