CAS 1607439-32-6 appears in our catalog under these names: 3-Chloromethcathinone Hydrochloride, 3–Chloromethcathinone (hydrochloride). Offered by: TRC, GLPBio. Available pack sizes: 10mg, 50mg, 1mg, 5mg.
1-(3-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 1607439-32-6) is a chemical compound with the molecular formula C10H13Cl2NO and a molecular weight of 234.12 g/mol. IUPAC name: 1-(3-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: QXEPSICDXPPHTO-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | QXEPSICDXPPHTO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)NC.Cl |
Computed by PubChem (NCBI)