Products 160776-83-0
CAS 160776-83-0 appears in our catalog under these names: 1-Dodecan-d25-ol, n-Dodecyl-d25 Alcohol, 98 atom % D, min 98% Chemical Purity, 1–dodecan–D25–ol, 1–Dodecanol–d25, 1-Dodecanol-d25, 98.09%. Offered by: TRC, CDN, GLPBio, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 50mg, 0,5g, 0,25g, 5mg, 10 mg, 50 mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-ol (CAS 160776-83-0) is a chemical compound with the molecular formula C12H26O and a molecular weight of 211.49 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-ol. InChIKey: LQZZUXJYWNFBMV-VVZIYBSUSA-N.
| Molecular formula | C12H26O |
|---|---|
| Molecular weight | 211.49 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosadeuteriododecan-1-ol |
| InChIKey | LQZZUXJYWNFBMV-VVZIYBSUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)