Products 38086-03-2
CAS 38086-03-2 appears in our catalog under these names: n-Dodecyl Alcohol-d26, 98 atom % D, min 98% Chemical Purity, 1-Dodecanol-d26. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 25 mg, 10 mg, 50 mg, 100 mg.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosadeuterio-12-deuteriooxydodecane (CAS 38086-03-2) is a chemical compound with the molecular formula C12H26O and a molecular weight of 212.49 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosadeuterio-12-deuteriooxydodecane. InChIKey: LQZZUXJYWNFBMV-XVPUMJERSA-N.
| Molecular formula | C12H26O |
|---|---|
| Molecular weight | 212.49 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosadeuterio-12-deuteriooxydodecane |
| InChIKey | LQZZUXJYWNFBMV-XVPUMJERSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O[2H] |
Computed by PubChem (NCBI)