CAS 16078-38-9 is the registry number for 1-Benzoyl-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,4-dihydro-2H-quinolin-1-yl(phenyl)methanone (CAS 16078-38-9) is a chemical compound with the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. IUPAC name: 3,4-dihydro-2H-quinolin-1-yl(phenyl)methanone. InChIKey: CEBQABUYWIZVHQ-UHFFFAOYSA-N.
| Molecular formula | C16H15NO |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 3,4-dihydro-2H-quinolin-1-yl(phenyl)methanone |
| InChIKey | CEBQABUYWIZVHQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)