Products 1608784-68-4
CAS 1608784-68-4 appears in our catalog under these names: T-10418, 99.78%, T-10418, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 50 mg, 10 mg, 10mM/1mL, 25 mg, 100 mg, 5 mg, 250mg.
(2R)-3-phenyl-2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]propanoic acid (CAS 1608784-68-4) is a chemical compound with the molecular formula C22H20N2O4 and a molecular weight of 376.4 g/mol. IUPAC name: (2R)-3-phenyl-2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]propanoic acid. InChIKey: JGLGMFHQGRAHAO-HXUWFJFHSA-N.
| Molecular formula | C22H20N2O4 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (2R)-3-phenyl-2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]propanoic acid |
| InChIKey | JGLGMFHQGRAHAO-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC(=O)C2=CC(=CC=C2)OCC3=CN=CC=C3 |
Computed by PubChem (NCBI)