Products 2247657-44-7
CAS 2247657-44-7 is the registry number for Fmoc-L-Ala(N-Pyrr)-OH. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrrol-1-ylpropanoic acid (CAS 2247657-44-7) is a chemical compound with the molecular formula C22H20N2O4 and a molecular weight of 376.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrrol-1-ylpropanoic acid. InChIKey: JOMKLUODADXTIR-FQEVSTJZSA-N.
| Molecular formula | C22H20N2O4 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyrrol-1-ylpropanoic acid |
| InChIKey | JOMKLUODADXTIR-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN4C=CC=C4)C(=O)O |
Computed by PubChem (NCBI)