CAS 1609388-45-5 appears in our catalog under these names: 3-Methyl-5-[(2s)-2-pyrrolidinyl]-1,2,4-oxadiazole hydrochloride, 95%, 3-Methyl-5-((2S)-2-pyrrolidinyl)-1,2,4-oxadiazole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride (CAS 1609388-45-5) is a chemical compound with the molecular formula C7H12ClN3O and a molecular weight of 189.64 g/mol. IUPAC name: 3-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride. InChIKey: WJESNAGBIGVDJP-RGMNGODLSA-N.
| Molecular formula | C7H12ClN3O |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 3-methyl-5-[(2S)-pyrrolidin-2-yl]-1,2,4-oxadiazole;hydrochloride |
| InChIKey | WJESNAGBIGVDJP-RGMNGODLSA-N |
| SMILES | CC1=NOC(=N1)[C@@H]2CCCN2.Cl |
Computed by PubChem (NCBI)