CAS 913980-23-1 appears in our catalog under these names: Vildagliptin Impurity 52 HCl, Gly-Pro-CN Hydrochloride Salt. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;hydrochloride (CAS 913980-23-1) is a chemical compound with the molecular formula C7H12ClN3O and a molecular weight of 189.64 g/mol. IUPAC name: (2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;hydrochloride. InChIKey: BKHDYBMGEZPELT-RGMNGODLSA-N.
| Molecular formula | C7H12ClN3O |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | (2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonitrile;hydrochloride |
| InChIKey | BKHDYBMGEZPELT-RGMNGODLSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CN)C#N.Cl |
Computed by PubChem (NCBI)