CAS 16094-31-8 appears in our catalog under these names: 5-tert-Butyl-2-hydroxybenzoic acid, 96%, 5–tert–Butyl–2–hydroxybenzoic Acid, 5-tert-Butyl-2-hydroxybenzoic acid, 5-tert-Butyl-2-hydroxybenzoic Acid 97%, 5-tert-Butyl-2-hydroxybenzoic Acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 25g.
5-tert-butyl-2-hydroxybenzoic acid (CAS 16094-31-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 5-tert-butyl-2-hydroxybenzoic acid. InChIKey: XAICWTLLSRXZPB-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-tert-butyl-2-hydroxybenzoic acid |
| InChIKey | XAICWTLLSRXZPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)