CAS 1609401-26-4 is the registry number for [(1-Methyl-2-piperidinyl)methyl]amine diethanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1-methylpiperidin-2-yl)methanamine;oxalic acid (CAS 1609401-26-4) is a chemical compound with the molecular formula C11H20N2O8 and a molecular weight of 308.29 g/mol. IUPAC name: (1-methylpiperidin-2-yl)methanamine;oxalic acid. InChIKey: NWORQUFTTXAZJK-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O8 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | (1-methylpiperidin-2-yl)methanamine;oxalic acid |
| InChIKey | NWORQUFTTXAZJK-UHFFFAOYSA-N |
| SMILES | CN1CCCCC1CN.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)