Products 92755-70-9
CAS 92755-70-9 is the registry number for Santhopine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
(2S)-5-amino-5-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid (CAS 92755-70-9) is a chemical compound with the molecular formula C11H20N2O8 and a molecular weight of 308.29 g/mol. IUPAC name: (2S)-5-amino-5-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid. InChIKey: SNIATPDKUZZXAT-VISRLPHGSA-N.
| Molecular formula | C11H20N2O8 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | (2S)-5-amino-5-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5-tetrahydroxyoxan-2-yl]methylamino]pentanoic acid |
| InChIKey | SNIATPDKUZZXAT-VISRLPHGSA-N |
| SMILES | C1[C@H]([C@H]([C@@H]([C@](O1)(CN[C@@H](CCC(=O)N)C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)