Products 1609401-31-1
CAS 1609401-31-1 appears in our catalog under these names: [2-(2,6,7-Trimethyl-1h-indol-3-yl)ethyl]amine dihydrate, 95%, (2-(2,6,7-Trimethyl-1H-indol-3-yl)ethyl)amine dihydrate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
2-(2,6,7-trimethyl-1H-indol-3-yl)ethanamine;dihydrate (CAS 1609401-31-1) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: 2-(2,6,7-trimethyl-1H-indol-3-yl)ethanamine;dihydrate. InChIKey: RDYXHQJAGITSHO-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 2-(2,6,7-trimethyl-1H-indol-3-yl)ethanamine;dihydrate |
| InChIKey | RDYXHQJAGITSHO-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=C(N2)C)CCN)C.O.O |
Computed by PubChem (NCBI)