CAS 731827-28-4 appears in our catalog under these names: 8-(2-Methylbutan-2-yl)-1,3-diazaspiro[4.5]decane-2,4-dione, 95%, 8-(2-Methylbutan-2-yl)-1,3-diazaspiro(4.5)decane-2,4-dione, 95%, 8-(2-Methylbutan-2-yl)-1,3-diazaspiro(4.5)decane-2,4-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
8-(2-methylbutan-2-yl)-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 731827-28-4) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: 8-(2-methylbutan-2-yl)-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: PTMDUDZKTQCJTN-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 8-(2-methylbutan-2-yl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | PTMDUDZKTQCJTN-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1CCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)