CAS 1609403-46-4 appears in our catalog under these names: (8-Syn)-n,n-dimethyl-3-azabicyclo[3.2.1]octan-8-amine dihydrochloride, 95%, (8-Syn)-N,N-dimethyl-3-azabicyclo(3.2.1)octan-8-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g.
(1S,5R)-N,N-dimethyl-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride (CAS 1609403-46-4) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: (1S,5R)-N,N-dimethyl-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride. InChIKey: JAMWDTOOGPNTEH-XBFJVWQFSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | (1S,5R)-N,N-dimethyl-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride |
| InChIKey | JAMWDTOOGPNTEH-XBFJVWQFSA-N |
| SMILES | CN(C)C1[C@@H]2CC[C@H]1CNC2.Cl.Cl |
Computed by PubChem (NCBI)