CAS 1609403-65-7 is the registry number for 2,5,7-Trimethyl-4-quinolinecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,5,7-trimethylquinoline-4-carboxylic acid;hydrate (CAS 1609403-65-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 2,5,7-trimethylquinoline-4-carboxylic acid;hydrate. InChIKey: TVEUEDUQCOEJNU-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 2,5,7-trimethylquinoline-4-carboxylic acid;hydrate |
| InChIKey | TVEUEDUQCOEJNU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=NC2=C1)C)C(=O)O)C.O |
Computed by PubChem (NCBI)