Products 1609404-09-2

CAS 1609404-09-2 is the registry number for 1-(2-Pyridinylmethyl)piperazine diethanedioate. Offered by: Biosynth. Available pack sizes: 25g, 10g.

Structural formula: {0} (CAS {1})

Oxalic acid;1-(pyridin-2-ylmethyl)piperazine (CAS 1609404-09-2) is a chemical compound with the molecular formula C14H19N3O8 and a molecular weight of 357.32 g/mol. IUPAC name: oxalic acid;1-(pyridin-2-ylmethyl)piperazine. InChIKey: JXNZVMGCMJIMLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N3O8
Molecular weight357.32 g/mol
IUPAC nameoxalic acid;1-(pyridin-2-ylmethyl)piperazine
InChIKeyJXNZVMGCMJIMLQ-UHFFFAOYSA-N
SMILESC1CN(CCN1)CC2=CC=CC=N2.C(=O)(C(=O)O)O.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)