CAS 23911-26-4 appears in our catalog under these names: Diethylenetriaminepentaacetic dianhydride, 97%, NSC 379317, Diethylenetriaminepentaacetic acid dianhydride, Diethylenetriaminepentaacetic acid dianhydride, 95% , Diethylenetriaminepentaacetic acid dianhydride. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 100g, 2g, 10g.
2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]amino]acetic acid (CAS 23911-26-4) is a chemical compound with the molecular formula C14H19N3O8 and a molecular weight of 357.32 g/mol. IUPAC name: 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]amino]acetic acid. InChIKey: RAZLJUXJEOEYAM-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O8 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]amino]acetic acid |
| InChIKey | RAZLJUXJEOEYAM-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC(=O)CN1CCN(CCN2CC(=O)OC(=O)C2)CC(=O)O |
Computed by PubChem (NCBI)