CAS 1609406-40-7 is the registry number for (2-[Cis-2,6-dimethyl-1-piperidinyl]ethyl)amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethanamine;dihydrochloride (CAS 1609406-40-7) is a chemical compound with the molecular formula C9H22Cl2N2 and a molecular weight of 229.19 g/mol. IUPAC name: 2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethanamine;dihydrochloride. InChIKey: DKLACHRTHCMSIN-DRJPZDRJSA-N.
| Molecular formula | C9H22Cl2N2 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | 2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]ethanamine;dihydrochloride |
| InChIKey | DKLACHRTHCMSIN-DRJPZDRJSA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1CCN)C.Cl.Cl |
Computed by PubChem (NCBI)